C30H16F6N2S2 — CID 101376433
5,8-bis[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]quinoxaline (PubChem CID 101376433) has the molecular formula C30H16F6N2S2 and a molecular weight of 582.59 g/mol. Its IUPAC name is 5,8-bis[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]quinoxaline.
| Compound Name | 5,8-bis[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]quinoxaline |
|---|---|
| PubChem CID | 101376433 |
| Molecular Formula | C30H16F6N2S2 |
| Molecular Weight | 582.59 g/mol |
| Exact Mass | 582.07 |
| IUPAC Name | 5,8-bis[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]quinoxaline |
| SMILES | FC(F)(F)c1ccc(-c2ccc(-c3ccc(-c4ccc(-c5ccc(C(F)(F)F)cc5)s4)c4nccnc34)s2)cc1 |
| InChI | InChI=1S/C30H16F6N2S2/c31-29(32,33)19-5-1-17(2-6-19)23-11-13-25(39-23)21-9-10-22(28-27(21)37-15-16-38-28)26-14-12-24(40-26)18-3-7-20(8-4-18)30(34,35)36/h1-16H |
| InChIKey | XGYDEYVTVVFSBB-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.59 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |