C28H14F6N2S3 — CID 101437035
5,7-bis[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]thieno[3,4-b]pyrazine (PubChem CID 101437035) has the molecular formula C28H14F6N2S3 and a molecular weight of 588.62 g/mol. Its IUPAC name is 5,7-bis[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]thieno[3,4-b]pyrazine.
| Compound Name | 5,7-bis[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]thieno[3,4-b]pyrazine |
|---|---|
| PubChem CID | 101437035 |
| Molecular Formula | C28H14F6N2S3 |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 588.02 |
| IUPAC Name | 5,7-bis[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]thieno[3,4-b]pyrazine |
| SMILES | FC(F)(F)c1ccc(-c2ccc(-c3sc(-c4ccc(-c5ccc(C(F)(F)F)cc5)s4)c4nccnc34)s2)cc1 |
| InChI | InChI=1S/C28H14F6N2S3/c29-27(30,31)17-5-1-15(2-6-17)19-9-11-21(37-19)25-23-24(36-14-13-35-23)26(39-25)22-12-10-20(38-22)16-3-7-18(8-4-16)28(32,33)34/h1-14H |
| InChIKey | ZYKIWVNQEJEBOC-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |