C11H5Br2F3S — CID 53441536
2,3-dibromo-5-[4-(trifluoromethyl)phenyl]thiophene (PubChem CID 53441536) has the molecular formula C11H5Br2F3S and a molecular weight of 386.03 g/mol. Its IUPAC name is 2,3-dibromo-5-[4-(trifluoromethyl)phenyl]thiophene.
| Compound Name | 2,3-dibromo-5-[4-(trifluoromethyl)phenyl]thiophene |
|---|---|
| PubChem CID | 53441536 |
| Molecular Formula | C11H5Br2F3S |
| Molecular Weight | 386.03 g/mol |
| Exact Mass | 383.84 |
| IUPAC Name | 2,3-dibromo-5-[4-(trifluoromethyl)phenyl]thiophene |
| SMILES | FC(F)(F)c1ccc(-c2cc(Br)c(Br)s2)cc1 |
| InChI | InChI=1S/C11H5Br2F3S/c12-8-5-9(17-10(8)13)6-1-3-7(4-2-6)11(14,15)16/h1-5H |
| InChIKey | AETGWPXCHQYRTO-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.03 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |