C54H29F12OPS4 — CID 102315352
1-phenyl-2,3,4,5-tetrakis[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]-1λ5-phosphole 1-oxide (PubChem CID 102315352) has the molecular formula C54H29F12OPS4 and a molecular weight of 1081.04 g/mol. Its IUPAC name is 1-phenyl-2,3,4,5-tetrakis[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]-1λ5-phosphole 1-oxide.
| Compound Name | 1-phenyl-2,3,4,5-tetrakis[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]-1λ5-phosphole 1-oxide |
|---|---|
| PubChem CID | 102315352 |
| Molecular Formula | C54H29F12OPS4 |
| Molecular Weight | 1081.04 g/mol |
| Exact Mass | 1080.06 |
| IUPAC Name | 1-phenyl-2,3,4,5-tetrakis[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]-1λ5-phosphole 1-oxide |
| SMILES | O=P1(c2ccccc2)C(c2ccc(-c3ccc(C(F)(F)F)cc3)s2)=C(c2ccc(-c3ccc(C(F)(F)F)cc3)s2)C(c2ccc(-c3ccc(C(F)(F)F)cc3)s2)=C1c1ccc(-c2ccc(C(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C54H29F12OPS4/c55-51(56,57)34-14-6-30(7-15-34)39-22-26-43(69-39)47-48(44-27-23-40(70-44)31-8-16-35(17-9-31)52(58,59)60)50(46-29-25-42(72-46)33-12-20-37(21-13-33)54(64,65)66)68(67,38-4-2-1-3-5-38)49(47)45-28-24-41(71-45)32-10-18-36(19-11-32)53(61,62)63/h1-29H |
| InChIKey | KMXDYSXDRFNQEM-UHFFFAOYSA-N |
| XLogP | 19.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1081.04 |
| LogP ≤ 5 | 19.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|