C12H19F3N4O — CID 162614658
(3-amino-3,8-diazabicyclo[3.2.1]octan-8-yl)-[3-(trifluoromethyl)pyrrolidin-1-yl]methanone (PubChem CID 162614658) has the molecular formula C12H19F3N4O and a molecular weight of 292.31 g/mol. Its IUPAC name is (3-amino-3,8-diazabicyclo[3.2.1]octan-8-yl)-[3-(trifluoromethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (3-amino-3,8-diazabicyclo[3.2.1]octan-8-yl)-[3-(trifluoromethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 162614658 |
| Molecular Formula | C12H19F3N4O |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (3-amino-3,8-diazabicyclo[3.2.1]octan-8-yl)-[3-(trifluoromethyl)pyrrolidin-1-yl]methanone |
| SMILES | NN1CC2CCC(C1)N2C(=O)N1CCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H19F3N4O/c13-12(14,15)8-3-4-17(5-8)11(20)19-9-1-2-10(19)7-18(16)6-9/h8-10H,1-7,16H2 |
| InChIKey | DLQJTEODNHSTSN-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|