C9H15F3N4O — CID 154662980
3-amino-N-(2,2,2-trifluoroethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxamide (PubChem CID 154662980) has the molecular formula C9H15F3N4O and a molecular weight of 252.24 g/mol. Its IUPAC name is 3-amino-N-(2,2,2-trifluoroethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxamide.
| Compound Name | 3-amino-N-(2,2,2-trifluoroethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxamide |
|---|---|
| PubChem CID | 154662980 |
| Molecular Formula | C9H15F3N4O |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 3-amino-N-(2,2,2-trifluoroethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxamide |
| SMILES | NN1CC2CCC(C1)N2C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H15F3N4O/c10-9(11,12)5-14-8(17)16-6-1-2-7(16)4-15(13)3-6/h6-7H,1-5,13H2,(H,14,17) |
| InChIKey | CRHORULHILLKIY-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|