C8H9F3IN — CID 162614785
3-propan-2-yl-5-(trifluoromethyl)-1λ3-ioda-4-azacyclohexa-1,3,5-triene (PubChem CID 162614785) has the molecular formula C8H9F3IN and a molecular weight of 303.06 g/mol. Its IUPAC name is 3-propan-2-yl-5-(trifluoromethyl)-1λ3-ioda-4-azacyclohexa-1,3,5-triene.
| Compound Name | 3-propan-2-yl-5-(trifluoromethyl)-1λ3-ioda-4-azacyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 162614785 |
| Molecular Formula | C8H9F3IN |
| Molecular Weight | 303.06 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | 3-propan-2-yl-5-(trifluoromethyl)-1λ3-ioda-4-azacyclohexa-1,3,5-triene |
| SMILES | CC(C)C1=NC(C(F)(F)F)=CI=C1 |
| InChI | InChI=1S/C8H9F3IN/c1-5(2)6-3-12-4-7(13-6)8(9,10)11/h3-5H,1-2H3 |
| InChIKey | HKUAJBCFRMSDJQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.06 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|