C26H29F3IN3O3 — CID 162614837
methyl 1-[(2R,5R)-2-(1-iodopropan-2-yl)-5-methylcyclohexyl]-2-[4-(trifluoromethoxy)anilino]benzimidazole-5-carboxylate (PubChem CID 162614837) has the molecular formula C26H29F3IN3O3 and a molecular weight of 615.43 g/mol. Its IUPAC name is methyl 1-[(2R,5R)-2-(1-iodopropan-2-yl)-5-methylcyclohexyl]-2-[4-(trifluoromethoxy)anilino]benzimidazole-5-carboxylate.
| Compound Name | methyl 1-[(2R,5R)-2-(1-iodopropan-2-yl)-5-methylcyclohexyl]-2-[4-(trifluoromethoxy)anilino]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 162614837 |
| Molecular Formula | C26H29F3IN3O3 |
| Molecular Weight | 615.43 g/mol |
| Exact Mass | 615.12 |
| IUPAC Name | methyl 1-[(2R,5R)-2-(1-iodopropan-2-yl)-5-methylcyclohexyl]-2-[4-(trifluoromethoxy)anilino]benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)nc(Nc1ccc(OC(F)(F)F)cc1)n2C1C[C@H](C)CC[C@@H]1C(C)CI |
| InChI | InChI=1S/C26H29F3IN3O3/c1-15-4-10-20(16(2)14-30)23(12-15)33-22-11-5-17(24(34)35-3)13-21(22)32-25(33)31-18-6-8-19(9-7-18)36-26(27,28)29/h5-9,11,13,15-16,20,23H,4,10,12,14H2,1-3H3,(H,31,32)/t15-,16?,20-,23?/m1/s1 |
| InChIKey | MSSVYJAHAPTYFP-WPSIFHSWSA-N |
| XLogP | 7.51 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.43 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|