C27H21ClF3IN2O4 — CID 162615711
ethenyl 3-[2-chloro-3-[1,4-dimethyl-6-(trifluoromethyl)indole-2-carbonyl]-4-iodobenzoyl]-3-azabicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 162615711) has the molecular formula C27H21ClF3IN2O4 and a molecular weight of 656.83 g/mol. Its IUPAC name is ethenyl 3-[2-chloro-3-[1,4-dimethyl-6-(trifluoromethyl)indole-2-carbonyl]-4-iodobenzoyl]-3-azabicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | ethenyl 3-[2-chloro-3-[1,4-dimethyl-6-(trifluoromethyl)indole-2-carbonyl]-4-iodobenzoyl]-3-azabicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 162615711 |
| Molecular Formula | C27H21ClF3IN2O4 |
| Molecular Weight | 656.83 g/mol |
| Exact Mass | 656.02 |
| IUPAC Name | ethenyl 3-[2-chloro-3-[1,4-dimethyl-6-(trifluoromethyl)indole-2-carbonyl]-4-iodobenzoyl]-3-azabicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | C=COC(=O)C1C2CN(C(=O)c3ccc(I)c(C(=O)c4cc5c(C)cc(C(F)(F)F)cc5n4C)c3Cl)CC21 |
| InChI | InChI=1S/C27H21ClF3IN2O4/c1-4-38-26(37)21-16-10-34(11-17(16)21)25(36)14-5-6-18(32)22(23(14)28)24(35)20-9-15-12(2)7-13(27(29,30)31)8-19(15)33(20)3/h4-9,16-17,21H,1,10-11H2,2-3H3 |
| InChIKey | KRRKVWLHEKGNSL-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.83 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|