C16H16F2N2O3 — CID 162616012
[2-[4-(1,1-difluorobut-3-enyl)pyrazol-1-yl]-3-methoxyphenyl] acetate (PubChem CID 162616012) has the molecular formula C16H16F2N2O3 and a molecular weight of 322.31 g/mol. Its IUPAC name is [2-[4-(1,1-difluorobut-3-enyl)pyrazol-1-yl]-3-methoxyphenyl] acetate.
| Compound Name | [2-[4-(1,1-difluorobut-3-enyl)pyrazol-1-yl]-3-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 162616012 |
| Molecular Formula | C16H16F2N2O3 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | [2-[4-(1,1-difluorobut-3-enyl)pyrazol-1-yl]-3-methoxyphenyl] acetate |
| SMILES | C=CCC(F)(F)c1cnn(-c2c(OC)cccc2OC(C)=O)c1 |
| InChI | InChI=1S/C16H16F2N2O3/c1-4-8-16(17,18)12-9-19-20(10-12)15-13(22-3)6-5-7-14(15)23-11(2)21/h4-7,9-10H,1,8H2,2-3H3 |
| InChIKey | KUQMPPWSYYEEJN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|