C29H23F7IN4O3- — CID 162616856
CID 162616856 (PubChem CID 162616856) has the molecular formula C29H23F7IN4O3- and a molecular weight of 735.42 g/mol.
| Compound Name | CID 162616856 |
|---|---|
| PubChem CID | 162616856 |
| Molecular Formula | C29H23F7IN4O3- |
| Molecular Weight | 735.42 g/mol |
| Exact Mass | 735.07 |
| IUPAC Name | — |
| SMILES | CN1N(Cc2cccc(F)c2F)C(=O)C(C(=O)Nc2ccc(C(F)(F)[IH-])cc2-c2ccc(C(F)(F)F)nc2)=C(O)C12CCC2 |
| InChI | InChI=1S/C29H22F7IN4O3/c1-40-27(10-3-11-27)24(42)22(26(44)41(40)14-16-4-2-5-19(30)23(16)31)25(43)39-20-8-7-17(29(35,36)37)12-18(20)15-6-9-21(38-13-15)28(32,33)34/h2,4-9,12-13,42H,3,10-11,14H2,1H3,(H,39,43)/q-1 |
| InChIKey | VBJZGBVWUTYRRR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|