C27H22F5N3O3 — CID 90434020
N-[2-cyclopenta-1,3,4-trien-1-yl-4-(trifluoromethyl)phenyl]-2-[(2,3-difluorophenyl)methyl]-5-hydroxy-1,6,6-trimethyl-3-oxopyridazine-4-carboxamide (PubChem CID 90434020) has the molecular formula C27H22F5N3O3 and a molecular weight of 531.48 g/mol. Its IUPAC name is N-[2-cyclopenta-1,3,4-trien-1-yl-4-(trifluoromethyl)phenyl]-2-[(2,3-difluorophenyl)methyl]-5-hydroxy-1,6,6-trimethyl-3-oxopyridazine-4-carboxamide.
| Compound Name | N-[2-cyclopenta-1,3,4-trien-1-yl-4-(trifluoromethyl)phenyl]-2-[(2,3-difluorophenyl)methyl]-5-hydroxy-1,6,6-trimethyl-3-oxopyridazine-4-carboxamide |
|---|---|
| PubChem CID | 90434020 |
| Molecular Formula | C27H22F5N3O3 |
| Molecular Weight | 531.48 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | N-[2-cyclopenta-1,3,4-trien-1-yl-4-(trifluoromethyl)phenyl]-2-[(2,3-difluorophenyl)methyl]-5-hydroxy-1,6,6-trimethyl-3-oxopyridazine-4-carboxamide |
| SMILES | CN1N(Cc2cccc(F)c2F)C(=O)C(C(=O)Nc2ccc(C(F)(F)F)cc2C2=CC=C=C2)=C(O)C1(C)C |
| InChI | InChI=1S/C27H22F5N3O3/c1-26(2)23(36)21(25(38)35(34(26)3)14-16-9-6-10-19(28)22(16)29)24(37)33-20-12-11-17(27(30,31)32)13-18(20)15-7-4-5-8-15/h4,6-13,36H,14H2,1-3H3,(H,33,37) |
| InChIKey | DDVVXMNKIQNSNR-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.48 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|