C10H11ClF2N2O4 — CID 162618608
1-[(2R,5S)-5-(chloromethyl)-3,3-difluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 162618608) has the molecular formula C10H11ClF2N2O4 and a molecular weight of 296.66 g/mol. Its IUPAC name is 1-[(2R,5S)-5-(chloromethyl)-3,3-difluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5S)-5-(chloromethyl)-3,3-difluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 162618608 |
| Molecular Formula | C10H11ClF2N2O4 |
| Molecular Weight | 296.66 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 1-[(2R,5S)-5-(chloromethyl)-3,3-difluoro-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@@H]2O[C@@](CO)(CCl)CC2(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C10H11ClF2N2O4/c11-4-9(5-16)3-10(12,13)7(19-9)15-2-1-6(17)14-8(15)18/h1-2,7,16H,3-5H2,(H,14,17,18)/t7-,9-/m1/s1 |
| InChIKey | JAWBZWOVNCYXHR-VXNVDRBHSA-N |
| XLogP | 0.06 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.66 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|