C16H25ClF2N2O4Si — CID 174067509
1-[(2R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(chloromethyl)-3,3-difluorooxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 174067509) has the molecular formula C16H25ClF2N2O4Si and a molecular weight of 410.92 g/mol. Its IUPAC name is 1-[(2R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(chloromethyl)-3,3-difluorooxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(chloromethyl)-3,3-difluorooxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 174067509 |
| Molecular Formula | C16H25ClF2N2O4Si |
| Molecular Weight | 410.92 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 1-[(2R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(chloromethyl)-3,3-difluorooxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]1(CCl)CC(F)(F)[C@H](n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C16H25ClF2N2O4Si/c1-14(2,3)26(4,5)24-10-15(9-17)8-16(18,19)12(25-15)21-7-6-11(22)20-13(21)23/h6-7,12H,8-10H2,1-5H3,(H,20,22,23)/t12-,15-/m1/s1 |
| InChIKey | URHBPMGLMWIKJZ-IUODEOHRSA-N |
| XLogP | 3.09 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.92 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|