C26H22F3IN2O7 — CID 162621283
[(2R,5S)-3-benzoyloxy-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]oxolan-2-yl]methyl 5-iodo-5-methylcyclohepta-1,3,6-triene-1-carboxylate (PubChem CID 162621283) has the molecular formula C26H22F3IN2O7 and a molecular weight of 658.37 g/mol. Its IUPAC name is [(2R,5S)-3-benzoyloxy-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]oxolan-2-yl]methyl 5-iodo-5-methylcyclohepta-1,3,6-triene-1-carboxylate.
| Compound Name | [(2R,5S)-3-benzoyloxy-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]oxolan-2-yl]methyl 5-iodo-5-methylcyclohepta-1,3,6-triene-1-carboxylate |
|---|---|
| PubChem CID | 162621283 |
| Molecular Formula | C26H22F3IN2O7 |
| Molecular Weight | 658.37 g/mol |
| Exact Mass | 658.04 |
| IUPAC Name | [(2R,5S)-3-benzoyloxy-5-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]oxolan-2-yl]methyl 5-iodo-5-methylcyclohepta-1,3,6-triene-1-carboxylate |
| SMILES | CC1(I)C=CC=C(C(=O)OC[C@H]2O[C@H](n3cc(C(F)(F)F)c(=O)[nH]c3=O)CC2OC(=O)c2ccccc2)C=C1 |
| InChI | InChI=1S/C26H22F3IN2O7/c1-25(30)10-5-8-16(9-11-25)22(34)37-14-19-18(39-23(35)15-6-3-2-4-7-15)12-20(38-19)32-13-17(26(27,28)29)21(33)31-24(32)36/h2-11,13,18-20H,12,14H2,1H3,(H,31,33,36)/t18?,19-,20+,25?/m1/s1 |
| InChIKey | QRJGDZXWEIOZNX-PXRUUTNOSA-N |
| XLogP | 3.86 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|