C26H33F6N3O2 — CID 162621686
5-[3,5-bis(trifluoromethyl)phenyl]-1-(cyclohexylmethyl)-2-methylpyrrole-3-carboxylic acid;piperidin-1-amine (PubChem CID 162621686) has the molecular formula C26H33F6N3O2 and a molecular weight of 533.56 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)phenyl]-1-(cyclohexylmethyl)-2-methylpyrrole-3-carboxylic acid;piperidin-1-amine.
| Compound Name | 5-[3,5-bis(trifluoromethyl)phenyl]-1-(cyclohexylmethyl)-2-methylpyrrole-3-carboxylic acid;piperidin-1-amine |
|---|---|
| PubChem CID | 162621686 |
| Molecular Formula | C26H33F6N3O2 |
| Molecular Weight | 533.56 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)phenyl]-1-(cyclohexylmethyl)-2-methylpyrrole-3-carboxylic acid;piperidin-1-amine |
| SMILES | Cc1c(C(=O)O)cc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1CC1CCCCC1.NN1CCCCC1 |
| InChI | InChI=1S/C21H21F6NO2.C5H12N2/c1-12-17(19(29)30)10-18(28(12)11-13-5-3-2-4-6-13)14-7-15(20(22,23)24)9-16(8-14)21(25,26)27;6-7-4-2-1-3-5-7/h7-10,13H,2-6,11H2,1H3,(H,29,30);1-6H2 |
| InChIKey | JXFIMJPJXGQCKQ-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.56 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|