C23H33N3O3S — CID 70913607
3-tert-butyl-5-[1-(cyclohexylmethyl)-5-methyl-4-sulfamoylpyrrol-2-yl]benzamide (PubChem CID 70913607) has the molecular formula C23H33N3O3S and a molecular weight of 431.60 g/mol. Its IUPAC name is 3-tert-butyl-5-[1-(cyclohexylmethyl)-5-methyl-4-sulfamoylpyrrol-2-yl]benzamide.
| Compound Name | 3-tert-butyl-5-[1-(cyclohexylmethyl)-5-methyl-4-sulfamoylpyrrol-2-yl]benzamide |
|---|---|
| PubChem CID | 70913607 |
| Molecular Formula | C23H33N3O3S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 3-tert-butyl-5-[1-(cyclohexylmethyl)-5-methyl-4-sulfamoylpyrrol-2-yl]benzamide |
| SMILES | Cc1c(S(N)(=O)=O)cc(-c2cc(C(N)=O)cc(C(C)(C)C)c2)n1CC1CCCCC1 |
| InChI | InChI=1S/C23H33N3O3S/c1-15-21(30(25,28)29)13-20(26(15)14-16-8-6-5-7-9-16)17-10-18(22(24)27)12-19(11-17)23(2,3)4/h10-13,16H,5-9,14H2,1-4H3,(H2,24,27)(H2,25,28,29) |
| InChIKey | HPQUZYDTMDJETN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 108.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |