C27H42N2O2S — CID 70913716
1-(cyclohexylmethyl)-5-(3,5-ditert-butylphenyl)-2-ethylpyrrole-3-sulfonamide (PubChem CID 70913716) has the molecular formula C27H42N2O2S and a molecular weight of 458.71 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-5-(3,5-ditert-butylphenyl)-2-ethylpyrrole-3-sulfonamide.
| Compound Name | 1-(cyclohexylmethyl)-5-(3,5-ditert-butylphenyl)-2-ethylpyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 70913716 |
| Molecular Formula | C27H42N2O2S |
| Molecular Weight | 458.71 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | 1-(cyclohexylmethyl)-5-(3,5-ditert-butylphenyl)-2-ethylpyrrole-3-sulfonamide |
| SMILES | CCc1c(S(N)(=O)=O)cc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)n1CC1CCCCC1 |
| InChI | InChI=1S/C27H42N2O2S/c1-8-23-25(32(28,30)31)17-24(29(23)18-19-12-10-9-11-13-19)20-14-21(26(2,3)4)16-22(15-20)27(5,6)7/h14-17,19H,8-13,18H2,1-7H3,(H2,28,30,31) |
| InChIKey | CCFDMSFUOIWCQW-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.71 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |