C24H37N3O4S2 — CID 70913405
5-(3,5-ditert-butylphenyl)-2-methyl-1-piperidin-1-ylsulfonylpyrrole-3-sulfonamide (PubChem CID 70913405) has the molecular formula C24H37N3O4S2 and a molecular weight of 495.71 g/mol. Its IUPAC name is 5-(3,5-ditert-butylphenyl)-2-methyl-1-piperidin-1-ylsulfonylpyrrole-3-sulfonamide.
| Compound Name | 5-(3,5-ditert-butylphenyl)-2-methyl-1-piperidin-1-ylsulfonylpyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 70913405 |
| Molecular Formula | C24H37N3O4S2 |
| Molecular Weight | 495.71 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 5-(3,5-ditert-butylphenyl)-2-methyl-1-piperidin-1-ylsulfonylpyrrole-3-sulfonamide |
| SMILES | Cc1c(S(N)(=O)=O)cc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)n1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C24H37N3O4S2/c1-17-22(32(25,28)29)16-21(27(17)33(30,31)26-11-9-8-10-12-26)18-13-19(23(2,3)4)15-20(14-18)24(5,6)7/h13-16H,8-12H2,1-7H3,(H2,25,28,29) |
| InChIKey | MPHXHSYLPOWZRL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 102.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.71 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |