C25H36Cl2N2O2S — CID 70913853
2,4-dichloro-1-(cyclohexylmethyl)-5-(3,5-ditert-butylphenyl)pyrrole-3-sulfonamide (PubChem CID 70913853) has the molecular formula C25H36Cl2N2O2S and a molecular weight of 499.55 g/mol. Its IUPAC name is 2,4-dichloro-1-(cyclohexylmethyl)-5-(3,5-ditert-butylphenyl)pyrrole-3-sulfonamide.
| Compound Name | 2,4-dichloro-1-(cyclohexylmethyl)-5-(3,5-ditert-butylphenyl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 70913853 |
| Molecular Formula | C25H36Cl2N2O2S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 2,4-dichloro-1-(cyclohexylmethyl)-5-(3,5-ditert-butylphenyl)pyrrole-3-sulfonamide |
| SMILES | CC(C)(C)c1cc(-c2c(Cl)c(S(N)(=O)=O)c(Cl)n2CC2CCCCC2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H36Cl2N2O2S/c1-24(2,3)18-12-17(13-19(14-18)25(4,5)6)21-20(26)22(32(28,30)31)23(27)29(21)15-16-10-8-7-9-11-16/h12-14,16H,7-11,15H2,1-6H3,(H2,28,30,31) |
| InChIKey | YXSSYVAULGVWDQ-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |