C24H36N2O2S2 — CID 118160562
4-(cyclohexylmethyl)-5-(3,5-ditert-butylphenyl)-1,3-thiazole-2-sulfonamide (PubChem CID 118160562) has the molecular formula C24H36N2O2S2 and a molecular weight of 448.70 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-5-(3,5-ditert-butylphenyl)-1,3-thiazole-2-sulfonamide.
| Compound Name | 4-(cyclohexylmethyl)-5-(3,5-ditert-butylphenyl)-1,3-thiazole-2-sulfonamide |
|---|---|
| PubChem CID | 118160562 |
| Molecular Formula | C24H36N2O2S2 |
| Molecular Weight | 448.70 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 4-(cyclohexylmethyl)-5-(3,5-ditert-butylphenyl)-1,3-thiazole-2-sulfonamide |
| SMILES | CC(C)(C)c1cc(-c2sc(S(N)(=O)=O)nc2CC2CCCCC2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H36N2O2S2/c1-23(2,3)18-13-17(14-19(15-18)24(4,5)6)21-20(12-16-10-8-7-9-11-16)26-22(29-21)30(25,27)28/h13-16H,7-12H2,1-6H3,(H2,25,27,28) |
| InChIKey | MMGXJRCFCADXAZ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.70 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |