C24H35NO — CID 118160521
5-(cyclohexylmethyl)-4-(3,5-ditert-butylphenyl)-1,3-oxazole (PubChem CID 118160521) has the molecular formula C24H35NO and a molecular weight of 353.55 g/mol. Its IUPAC name is 5-(cyclohexylmethyl)-4-(3,5-ditert-butylphenyl)-1,3-oxazole.
| Compound Name | 5-(cyclohexylmethyl)-4-(3,5-ditert-butylphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 118160521 |
| Molecular Formula | C24H35NO |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | 5-(cyclohexylmethyl)-4-(3,5-ditert-butylphenyl)-1,3-oxazole |
| SMILES | CC(C)(C)c1cc(-c2ncoc2CC2CCCCC2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H35NO/c1-23(2,3)19-13-18(14-20(15-19)24(4,5)6)22-21(26-16-25-22)12-17-10-8-7-9-11-17/h13-17H,7-12H2,1-6H3 |
| InChIKey | YQBPXHLKHBROCL-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |