C27H33F3N6O3S — CID 162621744
3-amino-4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide;2-[3-(4-methylpiperazin-1-yl)propylamino]-1,3-thiazole-5-carboxylic acid (PubChem CID 162621744) has the molecular formula C27H33F3N6O3S and a molecular weight of 578.66 g/mol. Its IUPAC name is 3-amino-4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide;2-[3-(4-methylpiperazin-1-yl)propylamino]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 3-amino-4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide;2-[3-(4-methylpiperazin-1-yl)propylamino]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 162621744 |
| Molecular Formula | C27H33F3N6O3S |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | 3-amino-4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide;2-[3-(4-methylpiperazin-1-yl)propylamino]-1,3-thiazole-5-carboxylic acid |
| SMILES | CN1CCN(CCCNc2ncc(C(=O)O)s2)CC1.Cc1ccc(C(=O)Nc2cccc(C(F)(F)F)c2)cc1N |
| InChI | InChI=1S/C15H13F3N2O.C12H20N4O2S/c1-9-5-6-10(7-13(9)19)14(21)20-12-4-2-3-11(8-12)15(16,17)18;1-15-5-7-16(8-6-15)4-2-3-13-12-14-9-10(19-12)11(17)18/h2-8H,19H2,1H3,(H,20,21);9H,2-8H2,1H3,(H,13,14)(H,17,18) |
| InChIKey | OQJHRJZCLABTBP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 123.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|