C25H21F3N4O3S — CID 162621852
N-(3-amino-4-methylphenyl)-3-(trifluoromethyl)benzamide;2-anilino-1,3-thiazole-5-carboxylic acid (PubChem CID 162621852) has the molecular formula C25H21F3N4O3S and a molecular weight of 514.53 g/mol. Its IUPAC name is N-(3-amino-4-methylphenyl)-3-(trifluoromethyl)benzamide;2-anilino-1,3-thiazole-5-carboxylic acid.
| Compound Name | N-(3-amino-4-methylphenyl)-3-(trifluoromethyl)benzamide;2-anilino-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 162621852 |
| Molecular Formula | C25H21F3N4O3S |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | N-(3-amino-4-methylphenyl)-3-(trifluoromethyl)benzamide;2-anilino-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1ccc(NC(=O)c2cccc(C(F)(F)F)c2)cc1N.O=C(O)c1cnc(Nc2ccccc2)s1 |
| InChI | InChI=1S/C15H13F3N2O.C10H8N2O2S/c1-9-5-6-12(8-13(9)19)20-14(21)10-3-2-4-11(7-10)15(16,17)18;13-9(14)8-6-11-10(15-8)12-7-4-2-1-3-5-7/h2-8H,19H2,1H3,(H,20,21);1-6H,(H,11,12)(H,13,14) |
| InChIKey | FBGOLLDWLJJXJZ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|