C20H17F3N4O2 — CID 53339174
N-[3-[(5-aminopyrazin-2-yl)methoxy]-4-methylphenyl]-3-(trifluoromethyl)benzamide (PubChem CID 53339174) has the molecular formula C20H17F3N4O2 and a molecular weight of 402.38 g/mol. Its IUPAC name is N-[3-[(5-aminopyrazin-2-yl)methoxy]-4-methylphenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[(5-aminopyrazin-2-yl)methoxy]-4-methylphenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 53339174 |
| Molecular Formula | C20H17F3N4O2 |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | N-[3-[(5-aminopyrazin-2-yl)methoxy]-4-methylphenyl]-3-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(C(F)(F)F)c2)cc1OCc1cnc(N)cn1 |
| InChI | InChI=1S/C20H17F3N4O2/c1-12-5-6-15(8-17(12)29-11-16-9-26-18(24)10-25-16)27-19(28)13-3-2-4-14(7-13)20(21,22)23/h2-10H,11H2,1H3,(H2,24,26)(H,27,28) |
| InChIKey | HHJLDMQPWXADPH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |