C23H18F3N5O — CID 165113852
N-[3-[4-(6-amino-3-pyridinyl)pyrazol-1-yl]-4-methylphenyl]-3-(trifluoromethyl)benzamide (PubChem CID 165113852) has the molecular formula C23H18F3N5O and a molecular weight of 437.43 g/mol. Its IUPAC name is N-[3-[4-(6-amino-3-pyridinyl)pyrazol-1-yl]-4-methylphenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[4-(6-amino-3-pyridinyl)pyrazol-1-yl]-4-methylphenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 165113852 |
| Molecular Formula | C23H18F3N5O |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | N-[3-[4-(6-amino-3-pyridinyl)pyrazol-1-yl]-4-methylphenyl]-3-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(C(F)(F)F)c2)cc1-n1cc(-c2ccc(N)nc2)cn1 |
| InChI | InChI=1S/C23H18F3N5O/c1-14-5-7-19(30-22(32)15-3-2-4-18(9-15)23(24,25)26)10-20(14)31-13-17(12-29-31)16-6-8-21(27)28-11-16/h2-13H,1H3,(H2,27,28)(H,30,32) |
| InChIKey | WZQWUGGINBDNIO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |