C32H25FIN5O — CID 166921846
3-[4-(1-fluoro-1-iodoethyl)phenyl]-N-[4-methyl-3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazol-1-yl]phenyl]benzamide (PubChem CID 166921846) has the molecular formula C32H25FIN5O and a molecular weight of 641.49 g/mol. Its IUPAC name is 3-[4-(1-fluoro-1-iodoethyl)phenyl]-N-[4-methyl-3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazol-1-yl]phenyl]benzamide.
| Compound Name | 3-[4-(1-fluoro-1-iodoethyl)phenyl]-N-[4-methyl-3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazol-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 166921846 |
| Molecular Formula | C32H25FIN5O |
| Molecular Weight | 641.49 g/mol |
| Exact Mass | 641.11 |
| IUPAC Name | 3-[4-(1-fluoro-1-iodoethyl)phenyl]-N-[4-methyl-3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazol-1-yl]phenyl]benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(-c3ccc(C(C)(F)I)cc3)c2)cc1-n1cc(-c2cnc3[nH]ccc3c2)cn1 |
| InChI | InChI=1S/C32H25FIN5O/c1-20-6-11-28(16-29(20)39-19-26(18-37-39)25-15-23-12-13-35-30(23)36-17-25)38-31(40)24-5-3-4-22(14-24)21-7-9-27(10-8-21)32(2,33)34/h3-19H,1-2H3,(H,35,36)(H,38,40) |
| InChIKey | RHOBQJQZFZMVCY-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.49 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|