C15H13FN2O — CID 162625183
4-fluoro-2-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]aniline (PubChem CID 162625183) has the molecular formula C15H13FN2O and a molecular weight of 256.28 g/mol. Its IUPAC name is 4-fluoro-2-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]aniline.
| Compound Name | 4-fluoro-2-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]aniline |
|---|---|
| PubChem CID | 162625183 |
| Molecular Formula | C15H13FN2O |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 4-fluoro-2-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]aniline |
| SMILES | Nc1ccc(F)cc1C1=N[C@@H](c2ccccc2)CO1 |
| InChI | InChI=1S/C15H13FN2O/c16-11-6-7-13(17)12(8-11)15-18-14(9-19-15)10-4-2-1-3-5-10/h1-8,14H,9,17H2/t14-/m1/s1 |
| InChIKey | DPDMHPRHRQGXTG-CQSZACIVSA-N |
| XLogP | 2.93 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|