C18H20N4O3 — CID 162625218
N-[2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-5-nitropyridin-2-amine (PubChem CID 162625218) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-[2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-5-nitropyridin-2-amine.
| Compound Name | N-[2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 162625218 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-[2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-5-nitropyridin-2-amine |
| SMILES | CC(C)(C)[C@H]1COC(c2ccccc2Nc2ccc([N+](=O)[O-])cn2)=N1 |
| InChI | InChI=1S/C18H20N4O3/c1-18(2,3)15-11-25-17(21-15)13-6-4-5-7-14(13)20-16-9-8-12(10-19-16)22(23)24/h4-10,15H,11H2,1-3H3,(H,19,20)/t15-/m1/s1 |
| InChIKey | SXZGSHOBHXUULL-OAHLLOKOSA-N |
| XLogP | 3.92 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|