C20H15ClN4O3 — CID 162625235
3-chloro-5-nitro-N-[2-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]pyridin-2-amine (PubChem CID 162625235) has the molecular formula C20H15ClN4O3 and a molecular weight of 394.82 g/mol. Its IUPAC name is 3-chloro-5-nitro-N-[2-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]pyridin-2-amine.
| Compound Name | 3-chloro-5-nitro-N-[2-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 162625235 |
| Molecular Formula | C20H15ClN4O3 |
| Molecular Weight | 394.82 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 3-chloro-5-nitro-N-[2-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]pyridin-2-amine |
| SMILES | O=[N+]([O-])c1cnc(Nc2ccccc2C2=N[C@@H](c3ccccc3)CO2)c(Cl)c1 |
| InChI | InChI=1S/C20H15ClN4O3/c21-16-10-14(25(26)27)11-22-19(16)23-17-9-5-4-8-15(17)20-24-18(12-28-20)13-6-2-1-3-7-13/h1-11,18H,12H2,(H,22,23)/t18-/m1/s1 |
| InChIKey | PRQYEMYHXXCUGE-GOSISDBHSA-N |
| XLogP | 4.90 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.82 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|