C16H15F2N3O3 — CID 133435191
N-[2-(3,4-difluorophenyl)oxolan-3-yl]-4-methyl-5-nitropyridin-2-amine (PubChem CID 133435191) has the molecular formula C16H15F2N3O3 and a molecular weight of 335.31 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenyl)oxolan-3-yl]-4-methyl-5-nitropyridin-2-amine.
| Compound Name | N-[2-(3,4-difluorophenyl)oxolan-3-yl]-4-methyl-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 133435191 |
| Molecular Formula | C16H15F2N3O3 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-[2-(3,4-difluorophenyl)oxolan-3-yl]-4-methyl-5-nitropyridin-2-amine |
| SMILES | Cc1cc(NC2CCOC2c2ccc(F)c(F)c2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15F2N3O3/c1-9-6-15(19-8-14(9)21(22)23)20-13-4-5-24-16(13)10-2-3-11(17)12(18)7-10/h2-3,6-8,13,16H,4-5H2,1H3,(H,19,20) |
| InChIKey | HDIYYRSFGBUBQG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|