C17H17ClFN3O3 — CID 133422136
5-chloro-2-[4-[(4-fluorophenyl)methoxy]piperidin-1-yl]-3-nitropyridine (PubChem CID 133422136) has the molecular formula C17H17ClFN3O3 and a molecular weight of 365.79 g/mol. Its IUPAC name is 5-chloro-2-[4-[(4-fluorophenyl)methoxy]piperidin-1-yl]-3-nitropyridine.
| Compound Name | 5-chloro-2-[4-[(4-fluorophenyl)methoxy]piperidin-1-yl]-3-nitropyridine |
|---|---|
| PubChem CID | 133422136 |
| Molecular Formula | C17H17ClFN3O3 |
| Molecular Weight | 365.79 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 5-chloro-2-[4-[(4-fluorophenyl)methoxy]piperidin-1-yl]-3-nitropyridine |
| SMILES | O=[N+]([O-])c1cc(Cl)cnc1N1CCC(OCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H17ClFN3O3/c18-13-9-16(22(23)24)17(20-10-13)21-7-5-15(6-8-21)25-11-12-1-3-14(19)4-2-12/h1-4,9-10,15H,5-8,11H2 |
| InChIKey | CWLUPCSECYOOLY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.79 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|