C23H29N3O2S — CID 162625773
N-[[(1R,2S,3R,4S)-4-hydroxy-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-phenyl-6-azaspiro[2.4]heptan-1-yl]methyl]cyclobutanecarboxamide (PubChem CID 162625773) has the molecular formula C23H29N3O2S and a molecular weight of 411.57 g/mol. Its IUPAC name is N-[[(1R,2S,3R,4S)-4-hydroxy-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-phenyl-6-azaspiro[2.4]heptan-1-yl]methyl]cyclobutanecarboxamide.
| Compound Name | N-[[(1R,2S,3R,4S)-4-hydroxy-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-phenyl-6-azaspiro[2.4]heptan-1-yl]methyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 162625773 |
| Molecular Formula | C23H29N3O2S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | N-[[(1R,2S,3R,4S)-4-hydroxy-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-phenyl-6-azaspiro[2.4]heptan-1-yl]methyl]cyclobutanecarboxamide |
| SMILES | Cc1nc(CN2C[C@@H](O)[C@@]3(C2)[C@H](CNC(=O)C2CCC2)[C@H]3c2ccccc2)cs1 |
| InChI | InChI=1S/C23H29N3O2S/c1-15-25-18(13-29-15)11-26-12-20(27)23(14-26)19(10-24-22(28)17-8-5-9-17)21(23)16-6-3-2-4-7-16/h2-4,6-7,13,17,19-21,27H,5,8-12,14H2,1H3,(H,24,28)/t19-,20-,21-,23-/m1/s1 |
| InChIKey | IJIIGJNQBZRQQY-YYTDSSBASA-N |
| XLogP | 2.94 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |