C20H24N4O2S — CID 162632768
N-[[(1R,2S,3R,4S)-4-hydroxy-6-(3-methyl-1,2,4-thiadiazol-5-yl)-2-phenyl-6-azaspiro[2.4]heptan-1-yl]methyl]cyclopropanecarboxamide (PubChem CID 162632768) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is N-[[(1R,2S,3R,4S)-4-hydroxy-6-(3-methyl-1,2,4-thiadiazol-5-yl)-2-phenyl-6-azaspiro[2.4]heptan-1-yl]methyl]cyclopropanecarboxamide.
| Compound Name | N-[[(1R,2S,3R,4S)-4-hydroxy-6-(3-methyl-1,2,4-thiadiazol-5-yl)-2-phenyl-6-azaspiro[2.4]heptan-1-yl]methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 162632768 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-[[(1R,2S,3R,4S)-4-hydroxy-6-(3-methyl-1,2,4-thiadiazol-5-yl)-2-phenyl-6-azaspiro[2.4]heptan-1-yl]methyl]cyclopropanecarboxamide |
| SMILES | Cc1nsc(N2C[C@@H](O)[C@@]3(C2)[C@H](CNC(=O)C2CC2)[C@H]3c2ccccc2)n1 |
| InChI | InChI=1S/C20H24N4O2S/c1-12-22-19(27-23-12)24-10-16(25)20(11-24)15(9-21-18(26)14-7-8-14)17(20)13-5-3-2-4-6-13/h2-6,14-17,25H,7-11H2,1H3,(H,21,26)/t15-,16-,17-,20-/m1/s1 |
| InChIKey | ITEHHGIMHNLZHJ-WOCWXWTJSA-N |
| XLogP | 1.95 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |