C20H27N5O2S — CID 162625926
(3R,3aS,6aR)-5-[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]-N,N-dimethyl-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine (PubChem CID 162625926) has the molecular formula C20H27N5O2S and a molecular weight of 401.54 g/mol. Its IUPAC name is (3R,3aS,6aR)-5-[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]-N,N-dimethyl-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine.
| Compound Name | (3R,3aS,6aR)-5-[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]-N,N-dimethyl-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine |
|---|---|
| PubChem CID | 162625926 |
| Molecular Formula | C20H27N5O2S |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | (3R,3aS,6aR)-5-[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]-N,N-dimethyl-1,1-dioxo-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine |
| SMILES | CN(C)c1ccc(-c2ccnc(N3C[C@H]4[C@@H](N(C)C)CS(=O)(=O)[C@H]4C3)n2)cc1 |
| InChI | InChI=1S/C20H27N5O2S/c1-23(2)15-7-5-14(6-8-15)17-9-10-21-20(22-17)25-11-16-18(24(3)4)13-28(26,27)19(16)12-25/h5-10,16,18-19H,11-13H2,1-4H3/t16-,18-,19-/m0/s1 |
| InChIKey | RLVIMMGGCGYKPS-WDSOQIARSA-N |
| XLogP | 1.37 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |