C17H22N2O3 — CID 162627449
(3aS,6aS)-5-[3-(3-methoxy-4-methylphenyl)propanoyl]-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one (PubChem CID 162627449) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is (3aS,6aS)-5-[3-(3-methoxy-4-methylphenyl)propanoyl]-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one.
| Compound Name | (3aS,6aS)-5-[3-(3-methoxy-4-methylphenyl)propanoyl]-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one |
|---|---|
| PubChem CID | 162627449 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (3aS,6aS)-5-[3-(3-methoxy-4-methylphenyl)propanoyl]-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one |
| SMILES | COc1cc(CCC(=O)N2C[C@@H]3CNC(=O)[C@@H]3C2)ccc1C |
| InChI | InChI=1S/C17H22N2O3/c1-11-3-4-12(7-15(11)22-2)5-6-16(20)19-9-13-8-18-17(21)14(13)10-19/h3-4,7,13-14H,5-6,8-10H2,1-2H3,(H,18,21)/t13-,14+/m0/s1 |
| InChIKey | WQBSOBOBTGPEPB-UONOGXRCSA-N |
| XLogP | 1.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |