C14H22N4O3 — CID 162628644
methyl (3aS,6aS)-5-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylate (PubChem CID 162628644) has the molecular formula C14H22N4O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is methyl (3aS,6aS)-5-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylate.
| Compound Name | methyl (3aS,6aS)-5-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylate |
|---|---|
| PubChem CID | 162628644 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | methyl (3aS,6aS)-5-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylate |
| SMILES | COC(=O)[C@@]12COC[C@@H]1CN(Cc1nncn1C(C)C)C2 |
| InChI | InChI=1S/C14H22N4O3/c1-10(2)18-9-15-16-12(18)5-17-4-11-6-21-8-14(11,7-17)13(19)20-3/h9-11H,4-8H2,1-3H3/t11-,14-/m0/s1 |
| InChIKey | YSQYJMOQZLBCDI-FZMZJTMJSA-N |
| XLogP | 0.48 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |