C18H24N2O5S — CID 162632182
methyl 6-[4-[methyl(methylsulfonyl)amino]benzoyl]-6-azaspiro[2.5]octane-2-carboxylate (PubChem CID 162632182) has the molecular formula C18H24N2O5S and a molecular weight of 380.47 g/mol. Its IUPAC name is methyl 6-[4-[methyl(methylsulfonyl)amino]benzoyl]-6-azaspiro[2.5]octane-2-carboxylate.
| Compound Name | methyl 6-[4-[methyl(methylsulfonyl)amino]benzoyl]-6-azaspiro[2.5]octane-2-carboxylate |
|---|---|
| PubChem CID | 162632182 |
| Molecular Formula | C18H24N2O5S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | methyl 6-[4-[methyl(methylsulfonyl)amino]benzoyl]-6-azaspiro[2.5]octane-2-carboxylate |
| SMILES | COC(=O)C1CC12CCN(C(=O)c1ccc(N(C)S(C)(=O)=O)cc1)CC2 |
| InChI | InChI=1S/C18H24N2O5S/c1-19(26(3,23)24)14-6-4-13(5-7-14)16(21)20-10-8-18(9-11-20)12-15(18)17(22)25-2/h4-7,15H,8-12H2,1-3H3 |
| InChIKey | ADXQXEUYMLVYOT-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |