C16H22N2O5S — CID 50947988
methyl 1-[3-[methyl(methylsulfonyl)amino]benzoyl]piperidine-4-carboxylate (PubChem CID 50947988) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is methyl 1-[3-[methyl(methylsulfonyl)amino]benzoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[3-[methyl(methylsulfonyl)amino]benzoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 50947988 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | methyl 1-[3-[methyl(methylsulfonyl)amino]benzoyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)c2cccc(N(C)S(C)(=O)=O)c2)CC1 |
| InChI | InChI=1S/C16H22N2O5S/c1-17(24(3,21)22)14-6-4-5-13(11-14)15(19)18-9-7-12(8-10-18)16(20)23-2/h4-6,11-12H,7-10H2,1-3H3 |
| InChIKey | AJCWQKQALSKGOM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |