C22H23NO4S — CID 84558230
methyl 1-(3-phenacylsulfanylbenzoyl)piperidine-4-carboxylate (PubChem CID 84558230) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is methyl 1-(3-phenacylsulfanylbenzoyl)piperidine-4-carboxylate.
| Compound Name | methyl 1-(3-phenacylsulfanylbenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 84558230 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | methyl 1-(3-phenacylsulfanylbenzoyl)piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)c2cccc(SCC(=O)c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C22H23NO4S/c1-27-22(26)17-10-12-23(13-11-17)21(25)18-8-5-9-19(14-18)28-15-20(24)16-6-3-2-4-7-16/h2-9,14,17H,10-13,15H2,1H3 |
| InChIKey | VFUWBIVTQHYGHR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |