C21H26ClN3O2 — CID 162633742
N-[4-(4-chlorophenyl)-1,2-oxazol-5-yl]-1-cyclohexylpiperidine-3-carboxamide (PubChem CID 162633742) has the molecular formula C21H26ClN3O2 and a molecular weight of 387.91 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-1,2-oxazol-5-yl]-1-cyclohexylpiperidine-3-carboxamide.
| Compound Name | N-[4-(4-chlorophenyl)-1,2-oxazol-5-yl]-1-cyclohexylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 162633742 |
| Molecular Formula | C21H26ClN3O2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | N-[4-(4-chlorophenyl)-1,2-oxazol-5-yl]-1-cyclohexylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1oncc1-c1ccc(Cl)cc1)C1CCCN(C2CCCCC2)C1 |
| InChI | InChI=1S/C21H26ClN3O2/c22-17-10-8-15(9-11-17)19-13-23-27-21(19)24-20(26)16-5-4-12-25(14-16)18-6-2-1-3-7-18/h8-11,13,16,18H,1-7,12,14H2,(H,24,26) |
| InChIKey | ZUTFRTMFXMDXKZ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |