C19H22FN3OS — CID 162635513
[(3aS,6aS)-1-[(2-fluorophenyl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(2,4-dimethyl-1,3-thiazol-5-yl)methanone (PubChem CID 162635513) has the molecular formula C19H22FN3OS and a molecular weight of 359.47 g/mol. Its IUPAC name is [(3aS,6aS)-1-[(2-fluorophenyl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(2,4-dimethyl-1,3-thiazol-5-yl)methanone.
| Compound Name | [(3aS,6aS)-1-[(2-fluorophenyl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(2,4-dimethyl-1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 162635513 |
| Molecular Formula | C19H22FN3OS |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | [(3aS,6aS)-1-[(2-fluorophenyl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(2,4-dimethyl-1,3-thiazol-5-yl)methanone |
| SMILES | Cc1nc(C)c(C(=O)N2CC[C@H]3[C@@H]2CCN3Cc2ccccc2F)s1 |
| InChI | InChI=1S/C19H22FN3OS/c1-12-18(25-13(2)21-12)19(24)23-10-8-16-17(23)7-9-22(16)11-14-5-3-4-6-15(14)20/h3-6,16-17H,7-11H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | BOLIBJFBXXCOIR-IRXDYDNUSA-N |
| XLogP | 3.39 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |