C15H11FN2 — CID 162637917
5-(3-fluoro-5-methylphenyl)-1,6-naphthyridine (PubChem CID 162637917) has the molecular formula C15H11FN2 and a molecular weight of 238.27 g/mol. Its IUPAC name is 5-(3-fluoro-5-methylphenyl)-1,6-naphthyridine.
| Compound Name | 5-(3-fluoro-5-methylphenyl)-1,6-naphthyridine |
|---|---|
| PubChem CID | 162637917 |
| Molecular Formula | C15H11FN2 |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 5-(3-fluoro-5-methylphenyl)-1,6-naphthyridine |
| SMILES | Cc1cc(F)cc(-c2nccc3ncccc23)c1 |
| InChI | InChI=1S/C15H11FN2/c1-10-7-11(9-12(16)8-10)15-13-3-2-5-17-14(13)4-6-18-15/h2-9H,1H3 |
| InChIKey | BVNUXWXKAATKLP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |