C16H15N3 — CID 162638366
N,N-dimethyl-2-(1,6-naphthyridin-5-yl)aniline (PubChem CID 162638366) has the molecular formula C16H15N3 and a molecular weight of 249.32 g/mol. Its IUPAC name is N,N-dimethyl-2-(1,6-naphthyridin-5-yl)aniline.
| Compound Name | N,N-dimethyl-2-(1,6-naphthyridin-5-yl)aniline |
|---|---|
| PubChem CID | 162638366 |
| Molecular Formula | C16H15N3 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | N,N-dimethyl-2-(1,6-naphthyridin-5-yl)aniline |
| SMILES | CN(C)c1ccccc1-c1nccc2ncccc12 |
| InChI | InChI=1S/C16H15N3/c1-19(2)15-8-4-3-6-13(15)16-12-7-5-10-17-14(12)9-11-18-16/h3-11H,1-2H3 |
| InChIKey | AYTOWUAKCSDNJU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |