C12H13N3 — CID 68935131
N,N-dimethyl-2-pyridin-2-ylpyridin-3-amine (PubChem CID 68935131) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is N,N-dimethyl-2-pyridin-2-ylpyridin-3-amine.
| Compound Name | N,N-dimethyl-2-pyridin-2-ylpyridin-3-amine |
|---|---|
| PubChem CID | 68935131 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | N,N-dimethyl-2-pyridin-2-ylpyridin-3-amine |
| SMILES | CN(C)c1cccnc1-c1ccccn1 |
| InChI | InChI=1S/C12H13N3/c1-15(2)11-7-5-9-14-12(11)10-6-3-4-8-13-10/h3-9H,1-2H3 |
| InChIKey | FTOXFXWSWQPUQI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |