C18H15N5O — CID 162638492
N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]indolizine-3-carboxamide (PubChem CID 162638492) has the molecular formula C18H15N5O and a molecular weight of 317.35 g/mol. Its IUPAC name is N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]indolizine-3-carboxamide.
| Compound Name | N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]indolizine-3-carboxamide |
|---|---|
| PubChem CID | 162638492 |
| Molecular Formula | C18H15N5O |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]indolizine-3-carboxamide |
| SMILES | O=C(NCc1ccc(-n2cncn2)cc1)c1ccc2ccccn12 |
| InChI | InChI=1S/C18H15N5O/c24-18(17-9-8-15-3-1-2-10-22(15)17)20-11-14-4-6-16(7-5-14)23-13-19-12-21-23/h1-10,12-13H,11H2,(H,20,24) |
| InChIKey | AJHUMUBRYZLJRM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |