C12H11Cl3O — CID 162640058
2-chloro-1-[2-(2,2-dichloro-1-methylcyclopropyl)phenyl]ethanone (PubChem CID 162640058) has the molecular formula C12H11Cl3O and a molecular weight of 277.58 g/mol. Its IUPAC name is 2-chloro-1-[2-(2,2-dichloro-1-methylcyclopropyl)phenyl]ethanone.
| Compound Name | 2-chloro-1-[2-(2,2-dichloro-1-methylcyclopropyl)phenyl]ethanone |
|---|---|
| PubChem CID | 162640058 |
| Molecular Formula | C12H11Cl3O |
| Molecular Weight | 277.58 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | 2-chloro-1-[2-(2,2-dichloro-1-methylcyclopropyl)phenyl]ethanone |
| SMILES | CC1(c2ccccc2C(=O)CCl)CC1(Cl)Cl |
| InChI | InChI=1S/C12H11Cl3O/c1-11(7-12(11,14)15)9-5-3-2-4-8(9)10(16)6-13/h2-5H,6-7H2,1H3 |
| InChIKey | QVGITXRITDBADU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|