C22H14BrN3O2 — CID 162640156
4-(2-bromoanilino)spiro[1H-quinazoline-2,2'-indene]-1',3'-dione (PubChem CID 162640156) has the molecular formula C22H14BrN3O2 and a molecular weight of 432.28 g/mol. Its IUPAC name is 4-(2-bromoanilino)spiro[1H-quinazoline-2,2'-indene]-1',3'-dione.
| Compound Name | 4-(2-bromoanilino)spiro[1H-quinazoline-2,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 162640156 |
| Molecular Formula | C22H14BrN3O2 |
| Molecular Weight | 432.28 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | 4-(2-bromoanilino)spiro[1H-quinazoline-2,2'-indene]-1',3'-dione |
| SMILES | O=C1c2ccccc2C(=O)C12N=C(Nc1ccccc1Br)c1ccccc1N2 |
| InChI | InChI=1S/C22H14BrN3O2/c23-16-10-4-6-12-18(16)24-21-15-9-3-5-11-17(15)25-22(26-21)19(27)13-7-1-2-8-14(13)20(22)28/h1-12,25H,(H,24,26) |
| InChIKey | DASJEJDZSZGQFV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.28 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|