C25H51NO8P+ — CID 162640244
2-[hydroxy-[(2S)-2-nonanoyloxy-3-octanoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 162640244) has the molecular formula C25H51NO8P+ and a molecular weight of 524.66 g/mol. Its IUPAC name is 2-[hydroxy-[(2S)-2-nonanoyloxy-3-octanoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(2S)-2-nonanoyloxy-3-octanoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 162640244 |
| Molecular Formula | C25H51NO8P+ |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.33 |
| IUPAC Name | 2-[hydroxy-[(2S)-2-nonanoyloxy-3-octanoyloxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCCCCC(=O)O[C@@H](COC(=O)CCCCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C25H50NO8P/c1-6-8-10-12-14-16-18-25(28)34-23(21-31-24(27)17-15-13-11-9-7-2)22-33-35(29,30)32-20-19-26(3,4)5/h23H,6-22H2,1-5H3/p+1/t23-/m0/s1 |
| InChIKey | SPDCFOJFYHMXGE-QHCPKHFHSA-O |
| XLogP | 5.39 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|