C9H12N4O2 — CID 162640866
3,3,5,5-tetradeuterio-1-(6-nitro-3-pyridinyl)piperazine (PubChem CID 162640866) has the molecular formula C9H12N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 3,3,5,5-tetradeuterio-1-(6-nitro-3-pyridinyl)piperazine.
| Compound Name | 3,3,5,5-tetradeuterio-1-(6-nitro-3-pyridinyl)piperazine |
|---|---|
| PubChem CID | 162640866 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 3,3,5,5-tetradeuterio-1-(6-nitro-3-pyridinyl)piperazine |
| SMILES | [2H]C1([2H])CN(c2ccc([N+](=O)[O-])nc2)CC([2H])([2H])N1 |
| InChI | InChI=1S/C9H12N4O2/c14-13(15)9-2-1-8(7-11-9)12-5-3-10-4-6-12/h1-2,7,10H,3-6H2/i3D2,4D2 |
| InChIKey | UBCDLQPOKISIDX-KHORGVISSA-N |
| XLogP | 0.40 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|